C17H17FN2OS — CID 60525664
3-[5-(2-fluorophenyl)thiophen-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one (PubChem CID 60525664) has the molecular formula C17H17FN2OS and a molecular weight of 316.40 g/mol. Its IUPAC name is 3-[5-(2-fluorophenyl)thiophen-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one.
| Compound Name | 3-[5-(2-fluorophenyl)thiophen-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one |
|---|---|
| PubChem CID | 60525664 |
| Molecular Formula | C17H17FN2OS |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 3-[5-(2-fluorophenyl)thiophen-2-yl]-3,5,6,7,8,8a-hexahydro-2H-imidazo[1,5-a]pyridin-1-one |
| SMILES | O=C1NC(c2ccc(-c3ccccc3F)s2)N2CCCCC12 |
| InChI | InChI=1S/C17H17FN2OS/c18-12-6-2-1-5-11(12)14-8-9-15(22-14)16-19-17(21)13-7-3-4-10-20(13)16/h1-2,5-6,8-9,13,16H,3-4,7,10H2,(H,19,21) |
| InChIKey | OQWCYBNNNILNTH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |