C14H11F3N2O4 — CID 60526552
2-nitro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methoxy]pyridine (PubChem CID 60526552) has the molecular formula C14H11F3N2O4 and a molecular weight of 328.25 g/mol. Its IUPAC name is 2-nitro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methoxy]pyridine.
| Compound Name | 2-nitro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methoxy]pyridine |
|---|---|
| PubChem CID | 60526552 |
| Molecular Formula | C14H11F3N2O4 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-nitro-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methoxy]pyridine |
| SMILES | O=[N+]([O-])c1ncccc1OCc1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11F3N2O4/c15-14(16,17)9-23-11-5-3-10(4-6-11)8-22-12-2-1-7-18-13(12)19(20)21/h1-7H,8-9H2 |
| InChIKey | YPUDRBLCAPXCMG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 74.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|