C24H21N3O3S — CID 60528401
methyl 2-[2-[[4-(benzimidazol-1-yl)phenyl]carbamoyl]phenyl]sulfanylpropanoate (PubChem CID 60528401) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is methyl 2-[2-[[4-(benzimidazol-1-yl)phenyl]carbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl 2-[2-[[4-(benzimidazol-1-yl)phenyl]carbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 60528401 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | methyl 2-[2-[[4-(benzimidazol-1-yl)phenyl]carbamoyl]phenyl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1ccccc1C(=O)Nc1ccc(-n2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C24H21N3O3S/c1-16(24(29)30-2)31-22-10-6-3-7-19(22)23(28)26-17-11-13-18(14-12-17)27-15-25-20-8-4-5-9-21(20)27/h3-16H,1-2H3,(H,26,28) |
| InChIKey | DSTTXRWCDQAYLU-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |