C18H19NO4S — CID 94033049
methyl (2S)-2-[2-[(4-methoxyphenyl)carbamoyl]phenyl]sulfanylpropanoate (PubChem CID 94033049) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is methyl (2S)-2-[2-[(4-methoxyphenyl)carbamoyl]phenyl]sulfanylpropanoate.
| Compound Name | methyl (2S)-2-[2-[(4-methoxyphenyl)carbamoyl]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 94033049 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl (2S)-2-[2-[(4-methoxyphenyl)carbamoyl]phenyl]sulfanylpropanoate |
| SMILES | COC(=O)[C@H](C)Sc1ccccc1C(=O)Nc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-12(18(21)23-3)24-16-7-5-4-6-15(16)17(20)19-13-8-10-14(22-2)11-9-13/h4-12H,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | BWVHTUQCTYDPOI-LBPRGKRZSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |