C22H23N3O3 — CID 60530589
3-[2-[[2-(2,4-dimethylquinolin-3-yl)acetyl]amino]phenoxy]propanamide (PubChem CID 60530589) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[2-[[2-(2,4-dimethylquinolin-3-yl)acetyl]amino]phenoxy]propanamide.
| Compound Name | 3-[2-[[2-(2,4-dimethylquinolin-3-yl)acetyl]amino]phenoxy]propanamide |
|---|---|
| PubChem CID | 60530589 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 3-[2-[[2-(2,4-dimethylquinolin-3-yl)acetyl]amino]phenoxy]propanamide |
| SMILES | Cc1nc2ccccc2c(C)c1CC(=O)Nc1ccccc1OCCC(N)=O |
| InChI | InChI=1S/C22H23N3O3/c1-14-16-7-3-4-8-18(16)24-15(2)17(14)13-22(27)25-19-9-5-6-10-20(19)28-12-11-21(23)26/h3-10H,11-13H2,1-2H3,(H2,23,26)(H,25,27) |
| InChIKey | AXNHEQXGOXWKCO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |