C17H21F3N2O2 — CID 60531568
1-butanoyl-N-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide (PubChem CID 60531568) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-butanoyl-N-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-butanoyl-N-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 60531568 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-butanoyl-N-[4-methyl-3-(trifluoromethyl)phenyl]pyrrolidine-2-carboxamide |
| SMILES | CCCC(=O)N1CCCC1C(=O)Nc1ccc(C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F3N2O2/c1-3-5-15(23)22-9-4-6-14(22)16(24)21-12-8-7-11(2)13(10-12)17(18,19)20/h7-8,10,14H,3-6,9H2,1-2H3,(H,21,24) |
| InChIKey | IVILKMCDJGGKFA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |