C18H16F3N3O5 — CID 25108525
(2S)-1-(2-formamidoacetyl)-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide (PubChem CID 25108525) has the molecular formula C18H16F3N3O5 and a molecular weight of 411.34 g/mol. Its IUPAC name is (2S)-1-(2-formamidoacetyl)-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-formamidoacetyl)-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 25108525 |
| Molecular Formula | C18H16F3N3O5 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (2S)-1-(2-formamidoacetyl)-N-[2-oxo-4-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide |
| SMILES | O=CNCC(=O)N1CCC[C@H]1C(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H16F3N3O5/c19-18(20,21)12-7-16(27)29-14-6-10(3-4-11(12)14)23-17(28)13-2-1-5-24(13)15(26)8-22-9-25/h3-4,6-7,9,13H,1-2,5,8H2,(H,22,25)(H,23,28)/t13-/m0/s1 |
| InChIKey | VVZWMVAJGGZQKW-ZDUSSCGKSA-N |
| XLogP | 1.49 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|