C18H18F3N3O4 — CID 122443650
(2S)-1-[(2S)-2-aminopropanoyl]-N-[2-oxo-3-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide (PubChem CID 122443650) has the molecular formula C18H18F3N3O4 and a molecular weight of 397.35 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-aminopropanoyl]-N-[2-oxo-3-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2S)-2-aminopropanoyl]-N-[2-oxo-3-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122443650 |
| Molecular Formula | C18H18F3N3O4 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | (2S)-1-[(2S)-2-aminopropanoyl]-N-[2-oxo-3-(trifluoromethyl)chromen-7-yl]pyrrolidine-2-carboxamide |
| SMILES | C[C@H](N)C(=O)N1CCC[C@H]1C(=O)Nc1ccc2cc(C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C18H18F3N3O4/c1-9(22)16(26)24-6-2-3-13(24)15(25)23-11-5-4-10-7-12(18(19,20)21)17(27)28-14(10)8-11/h4-5,7-9,13H,2-3,6,22H2,1H3,(H,23,25)/t9-,13-/m0/s1 |
| InChIKey | HHGWVFJRDUMUJS-ZANVPECISA-N |
| XLogP | 2.09 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|