C15H11F2N3O2S — CID 60532169
2,6-difluoro-N-(2-pyrazol-1-ylphenyl)benzenesulfonamide (PubChem CID 60532169) has the molecular formula C15H11F2N3O2S and a molecular weight of 335.34 g/mol. Its IUPAC name is 2,6-difluoro-N-(2-pyrazol-1-ylphenyl)benzenesulfonamide.
| Compound Name | 2,6-difluoro-N-(2-pyrazol-1-ylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60532169 |
| Molecular Formula | C15H11F2N3O2S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2,6-difluoro-N-(2-pyrazol-1-ylphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-n1cccn1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H11F2N3O2S/c16-11-5-3-6-12(17)15(11)23(21,22)19-13-7-1-2-8-14(13)20-10-4-9-18-20/h1-10,19H |
| InChIKey | GPSQCQRTSQHAAZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |