C26H23F3N4O3 — CID 60532448
1-(4-methylphenyl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 60532448) has the molecular formula C26H23F3N4O3 and a molecular weight of 496.49 g/mol. Its IUPAC name is 1-(4-methylphenyl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(4-methylphenyl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 60532448 |
| Molecular Formula | C26H23F3N4O3 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | 1-(4-methylphenyl)-N-[[6-(2-phenoxyethoxy)-3-pyridinyl]methyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2ncc(C(=O)NCc3ccc(OCCOc4ccccc4)nc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H23F3N4O3/c1-18-7-10-20(11-8-18)33-24(26(27,28)29)22(17-32-33)25(34)31-16-19-9-12-23(30-15-19)36-14-13-35-21-5-3-2-4-6-21/h2-12,15,17H,13-14,16H2,1H3,(H,31,34) |
| InChIKey | CUUPPQKLSGGPIG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|