C16H20ClF3N4O — CID 119508538
N-[2-(ethylamino)ethyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride (PubChem CID 119508538) has the molecular formula C16H20ClF3N4O and a molecular weight of 376.81 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119508538 |
| Molecular Formula | C16H20ClF3N4O |
| Molecular Weight | 376.81 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide;hydrochloride |
| SMILES | CCNCCNC(=O)c1cnn(-c2ccc(C)cc2)c1C(F)(F)F.Cl |
| InChI | InChI=1S/C16H19F3N4O.ClH/c1-3-20-8-9-21-15(24)13-10-22-23(14(13)16(17,18)19)12-6-4-11(2)5-7-12;/h4-7,10,20H,3,8-9H2,1-2H3,(H,21,24);1H |
| InChIKey | LDEWBEGHBTVGDS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|