C18H22F3N3O — CID 43060647
N-(4-methylpentyl)-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 43060647) has the molecular formula C18H22F3N3O and a molecular weight of 353.39 g/mol. Its IUPAC name is N-(4-methylpentyl)-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(4-methylpentyl)-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 43060647 |
| Molecular Formula | C18H22F3N3O |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | N-(4-methylpentyl)-1-(4-methylphenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(-n2ncc(C(=O)NCCCC(C)C)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H22F3N3O/c1-12(2)5-4-10-22-17(25)15-11-23-24(16(15)18(19,20)21)14-8-6-13(3)7-9-14/h6-9,11-12H,4-5,10H2,1-3H3,(H,22,25) |
| InChIKey | OYWMNFFTTRPZOU-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|