C21H20N2O4 — CID 60534017
(E)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-(furan-2-yl)prop-2-enamide (PubChem CID 60534017) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is (E)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-(furan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-(furan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 60534017 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | (E)-N-[[2-(4-ethoxyphenoxy)-4-pyridinyl]methyl]-3-(furan-2-yl)prop-2-enamide |
| SMILES | CCOc1ccc(Oc2cc(CNC(=O)/C=C/c3ccco3)ccn2)cc1 |
| InChI | InChI=1S/C21H20N2O4/c1-2-25-18-5-7-19(8-6-18)27-21-14-16(11-12-22-21)15-23-20(24)10-9-17-4-3-13-26-17/h3-14H,2,15H2,1H3,(H,23,24)/b10-9+ |
| InChIKey | DFSRJDUYBPVRPP-MDZDMXLPSA-N |
| XLogP | 4.20 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|