C16H18FNO4S — CID 60534153
N-ethyl-N-(3-fluorophenyl)-2,5-dimethoxybenzenesulfonamide (PubChem CID 60534153) has the molecular formula C16H18FNO4S and a molecular weight of 339.39 g/mol. Its IUPAC name is N-ethyl-N-(3-fluorophenyl)-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-ethyl-N-(3-fluorophenyl)-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 60534153 |
| Molecular Formula | C16H18FNO4S |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-ethyl-N-(3-fluorophenyl)-2,5-dimethoxybenzenesulfonamide |
| SMILES | CCN(c1cccc(F)c1)S(=O)(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C16H18FNO4S/c1-4-18(13-7-5-6-12(17)10-13)23(19,20)16-11-14(21-2)8-9-15(16)22-3/h5-11H,4H2,1-3H3 |
| InChIKey | QGYHWCWWKGEFMC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |