C20H20N2O3S — CID 60534940
N,N,4-trimethyl-3-(naphthalen-2-ylsulfonylamino)benzamide (PubChem CID 60534940) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is N,N,4-trimethyl-3-(naphthalen-2-ylsulfonylamino)benzamide.
| Compound Name | N,N,4-trimethyl-3-(naphthalen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 60534940 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | N,N,4-trimethyl-3-(naphthalen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1ccc(C(=O)N(C)C)cc1NS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H20N2O3S/c1-14-8-9-17(20(23)22(2)3)13-19(14)21-26(24,25)18-11-10-15-6-4-5-7-16(15)12-18/h4-13,21H,1-3H3 |
| InChIKey | CMRPDSZVUWVVDQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |