C15H18N2O2S — CID 6053637
(E)-N-(oxolan-2-ylmethylcarbamothioyl)-3-phenylprop-2-enamide (PubChem CID 6053637) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is (E)-N-(oxolan-2-ylmethylcarbamothioyl)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(oxolan-2-ylmethylcarbamothioyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6053637 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (E)-N-(oxolan-2-ylmethylcarbamothioyl)-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)NCC1CCCO1 |
| InChI | InChI=1S/C15H18N2O2S/c18-14(9-8-12-5-2-1-3-6-12)17-15(20)16-11-13-7-4-10-19-13/h1-3,5-6,8-9,13H,4,7,10-11H2,(H2,16,17,18,20)/b9-8+ |
| InChIKey | SNIGRLULBBQIGQ-CMDGGOBGSA-N |
| XLogP | 1.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|