C27H25FN4O3 — CID 60538144
4-fluoro-N-[4-[1-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]ethyl]phenyl]benzamide (PubChem CID 60538144) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is 4-fluoro-N-[4-[1-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]ethyl]phenyl]benzamide.
| Compound Name | 4-fluoro-N-[4-[1-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 60538144 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-fluoro-N-[4-[1-[3-(8-methyl-4-oxoquinazolin-3-yl)propanoylamino]ethyl]phenyl]benzamide |
| SMILES | Cc1cccc2c(=O)n(CCC(=O)NC(C)c3ccc(NC(=O)c4ccc(F)cc4)cc3)cnc12 |
| InChI | InChI=1S/C27H25FN4O3/c1-17-4-3-5-23-25(17)29-16-32(27(23)35)15-14-24(33)30-18(2)19-8-12-22(13-9-19)31-26(34)20-6-10-21(28)11-7-20/h3-13,16,18H,14-15H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | HZNCEJGGAYJVQO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |