C22H24FN3O2 — CID 18121933
N-[1-(4-fluorophenyl)ethyl]-N-methyl-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide (PubChem CID 18121933) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-N-methyl-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-N-methyl-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 18121933 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-N-methyl-4-(8-methyl-4-oxoquinazolin-3-yl)butanamide |
| SMILES | Cc1cccc2c(=O)n(CCCC(=O)N(C)C(C)c3ccc(F)cc3)cnc12 |
| InChI | InChI=1S/C22H24FN3O2/c1-15-6-4-7-19-21(15)24-14-26(22(19)28)13-5-8-20(27)25(3)16(2)17-9-11-18(23)12-10-17/h4,6-7,9-12,14,16H,5,8,13H2,1-3H3 |
| InChIKey | GQBUQRJULKSVNJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |