C18H37N3O — CID 60542704
2-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]-N-heptan-2-ylacetamide (PubChem CID 60542704) has the molecular formula C18H37N3O and a molecular weight of 311.51 g/mol. Its IUPAC name is 2-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]-N-heptan-2-ylacetamide.
| Compound Name | 2-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]-N-heptan-2-ylacetamide |
|---|---|
| PubChem CID | 60542704 |
| Molecular Formula | C18H37N3O |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.29 |
| IUPAC Name | 2-[4-[2-(dimethylamino)ethyl]piperidin-1-yl]-N-heptan-2-ylacetamide |
| SMILES | CCCCCC(C)NC(=O)CN1CCC(CCN(C)C)CC1 |
| InChI | InChI=1S/C18H37N3O/c1-5-6-7-8-16(2)19-18(22)15-21-13-10-17(11-14-21)9-12-20(3)4/h16-17H,5-15H2,1-4H3,(H,19,22) |
| InChIKey | QPNWSTMKSRTOAK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|