C17H28N2O3S2 — CID 60546381
2-butylsulfanyl-N-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]propanamide (PubChem CID 60546381) has the molecular formula C17H28N2O3S2 and a molecular weight of 372.56 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 60546381 |
| Molecular Formula | C17H28N2O3S2 |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 2-butylsulfanyl-N-[4-[methyl(propan-2-yl)sulfamoyl]phenyl]propanamide |
| SMILES | CCCCSC(C)C(=O)Nc1ccc(S(=O)(=O)N(C)C(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O3S2/c1-6-7-12-23-14(4)17(20)18-15-8-10-16(11-9-15)24(21,22)19(5)13(2)3/h8-11,13-14H,6-7,12H2,1-5H3,(H,18,20) |
| InChIKey | KBKGFOVEDKKRKK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|