C21H20N4O2S2 — CID 60546893
2-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one (PubChem CID 60546893) has the molecular formula C21H20N4O2S2 and a molecular weight of 424.55 g/mol. Its IUPAC name is 2-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 60546893 |
| Molecular Formula | C21H20N4O2S2 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[1-(3-ethyl-1,2,4-oxadiazol-5-yl)ethylsulfanyl]-6-phenyl-3-prop-2-enylthieno[3,2-d]pyrimidin-4-one |
| SMILES | C=CCn1c(SC(C)c2nc(CC)no2)nc2cc(-c3ccccc3)sc2c1=O |
| InChI | InChI=1S/C21H20N4O2S2/c1-4-11-25-20(26)18-15(12-16(29-18)14-9-7-6-8-10-14)22-21(25)28-13(3)19-23-17(5-2)24-27-19/h4,6-10,12-13H,1,5,11H2,2-3H3 |
| InChIKey | ORYLUYPVKHTMLO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|