C21H26N4O3S — CID 60549348
2,3,4,5,6-pentamethyl-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]benzenesulfonamide (PubChem CID 60549348) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentamethyl-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 60549348 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]benzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2cccc(OCCn3cncn3)c2)c(C)c1C |
| InChI | InChI=1S/C21H26N4O3S/c1-14-15(2)17(4)21(18(5)16(14)3)29(26,27)24-19-7-6-8-20(11-19)28-10-9-25-13-22-12-23-25/h6-8,11-13,24H,9-10H2,1-5H3 |
| InChIKey | RHAXPLOIVDOOOC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |