C14H14N4O3S2 — CID 55820522
N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide (PubChem CID 55820522) has the molecular formula C14H14N4O3S2 and a molecular weight of 350.43 g/mol. Its IUPAC name is N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55820522 |
| Molecular Formula | C14H14N4O3S2 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N-[3-[2-(1,2,4-triazol-1-yl)ethoxy]phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(OCCn2cncn2)c1)c1cccs1 |
| InChI | InChI=1S/C14H14N4O3S2/c19-23(20,14-5-2-8-22-14)17-12-3-1-4-13(9-12)21-7-6-18-11-15-10-16-18/h1-5,8-11,17H,6-7H2 |
| InChIKey | DKABONCVVRBOKB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |