C26H25FN4O2 — CID 60550111
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]acetamide (PubChem CID 60550111) has the molecular formula C26H25FN4O2 and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 60550111 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]acetamide |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)Cc3c(C)[nH]c4ccc(F)cc34)c2)c1 |
| InChI | InChI=1S/C26H25FN4O2/c1-16-5-3-7-20(11-16)30-26(33)31-21-8-4-6-18(12-21)15-28-25(32)14-22-17(2)29-24-10-9-19(27)13-23(22)24/h3-13,29H,14-15H2,1-2H3,(H,28,32)(H2,30,31,33) |
| InChIKey | ZJRDXLPZUPYZBS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|