C21H24FN3O4S — CID 91954220
2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide (PubChem CID 91954220) has the molecular formula C21H24FN3O4S and a molecular weight of 433.51 g/mol. Its IUPAC name is 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide.
| Compound Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 91954220 |
| Molecular Formula | C21H24FN3O4S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-[3-(2-methoxyethylsulfamoylmethyl)phenyl]acetamide |
| SMILES | COCCNS(=O)(=O)Cc1cccc(NC(=O)Cc2c(C)[nH]c3ccc(F)cc23)c1 |
| InChI | InChI=1S/C21H24FN3O4S/c1-14-18(19-11-16(22)6-7-20(19)24-14)12-21(26)25-17-5-3-4-15(10-17)13-30(27,28)23-8-9-29-2/h3-7,10-11,23-24H,8-9,12-13H2,1-2H3,(H,25,26) |
| InChIKey | DIXPBYKPCLEFLF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|