C22H20FN3O2 — CID 60550046
N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide (PubChem CID 60550046) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 60550046 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-2-(5-fluoro-2-methyl-1H-indol-3-yl)-N-methylacetamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)Cc2c(C)[nH]c3ccc(F)cc23)c1 |
| InChI | InChI=1S/C22H20FN3O2/c1-4-15-6-5-7-17(10-15)25-21(27)13-26(3)22(28)12-18-14(2)24-20-9-8-16(23)11-19(18)20/h1,5-11,24H,12-13H2,2-3H3,(H,25,27) |
| InChIKey | HILKLQRFKXKAFI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|