C22H24N2O3 — CID 55811040
3-(2-ethoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 55811040) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-(2-ethoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 3-(2-ethoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55811040 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 3-(2-ethoxyphenyl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)CCc2ccccc2OCC)c1 |
| InChI | InChI=1S/C22H24N2O3/c1-4-17-9-8-11-19(15-17)23-21(25)16-24(3)22(26)14-13-18-10-6-7-12-20(18)27-5-2/h1,6-12,15H,5,13-14,16H2,2-3H3,(H,23,25) |
| InChIKey | YWFNAMBWUUZCEN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|