C22H25N3O6S — CID 55958187
3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 55958187) has the molecular formula C22H25N3O6S and a molecular weight of 459.52 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55958187 |
| Molecular Formula | C22H25N3O6S |
| Molecular Weight | 459.52 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)sulfonylamino]-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)CCNS(=O)(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C22H25N3O6S/c1-5-16-7-6-8-17(13-16)24-21(26)15-25(2)22(27)11-12-23-32(28,29)18-9-10-19(30-3)20(14-18)31-4/h1,6-10,13-14,23H,11-12,15H2,2-4H3,(H,24,26) |
| InChIKey | HPGWTKMHCRYUBU-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|