C19H18N2O4S — CID 36673402
3-[(3-acetylphenyl)sulfonylamino]-N-(3-ethynylphenyl)propanamide (PubChem CID 36673402) has the molecular formula C19H18N2O4S and a molecular weight of 370.43 g/mol. Its IUPAC name is 3-[(3-acetylphenyl)sulfonylamino]-N-(3-ethynylphenyl)propanamide.
| Compound Name | 3-[(3-acetylphenyl)sulfonylamino]-N-(3-ethynylphenyl)propanamide |
|---|---|
| PubChem CID | 36673402 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 3-[(3-acetylphenyl)sulfonylamino]-N-(3-ethynylphenyl)propanamide |
| SMILES | C#Cc1cccc(NC(=O)CCNS(=O)(=O)c2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C19H18N2O4S/c1-3-15-6-4-8-17(12-15)21-19(23)10-11-20-26(24,25)18-9-5-7-16(13-18)14(2)22/h1,4-9,12-13,20H,10-11H2,2H3,(H,21,23) |
| InChIKey | AYQIRLWIPOREGH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|