C22H20N4O4 — CID 55810844
3-(1,4-dioxo-3H-phthalazin-2-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide (PubChem CID 55810844) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide.
| Compound Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 55810844 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 3-(1,4-dioxo-3H-phthalazin-2-yl)-N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methylpropanamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)CCn2[nH]c(=O)c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H20N4O4/c1-3-15-7-6-8-16(13-15)23-19(27)14-25(2)20(28)11-12-26-22(30)18-10-5-4-9-17(18)21(29)24-26/h1,4-10,13H,11-12,14H2,2H3,(H,23,27)(H,24,29) |
| InChIKey | JWEDRBIWGPBZEQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|