C18H14ClFN2O2 — CID 47049032
4-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-fluoro-N-methylbenzamide (PubChem CID 47049032) has the molecular formula C18H14ClFN2O2 and a molecular weight of 344.77 g/mol. Its IUPAC name is 4-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 4-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 47049032 |
| Molecular Formula | C18H14ClFN2O2 |
| Molecular Weight | 344.77 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 4-chloro-N-[2-(3-ethynylanilino)-2-oxoethyl]-2-fluoro-N-methylbenzamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)c2ccc(Cl)cc2F)c1 |
| InChI | InChI=1S/C18H14ClFN2O2/c1-3-12-5-4-6-14(9-12)21-17(23)11-22(2)18(24)15-8-7-13(19)10-16(15)20/h1,4-10H,11H2,2H3,(H,21,23) |
| InChIKey | HCTNUSWSAOGVDC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|