C24H19F3N4O2 — CID 55958188
N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide (PubChem CID 55958188) has the molecular formula C24H19F3N4O2 and a molecular weight of 452.44 g/mol. Its IUPAC name is N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide.
| Compound Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55958188 |
| Molecular Formula | C24H19F3N4O2 |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | N-[2-(3-ethynylanilino)-2-oxoethyl]-N-methyl-2-[3-(trifluoromethyl)anilino]pyridine-3-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)CN(C)C(=O)c2cccnc2Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C24H19F3N4O2/c1-3-16-7-4-9-18(13-16)29-21(32)15-31(2)23(33)20-11-6-12-28-22(20)30-19-10-5-8-17(14-19)24(25,26)27/h1,4-14H,15H2,2H3,(H,28,30)(H,29,32) |
| InChIKey | WNGBJXJMEFXTAL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|