C28H24N2O2S — CID 6055016
N-[(Z)-(7,12-dimethylbenzo[a]anthracen-5-yl)methylideneamino]-4-methylbenzenesulfonamide (PubChem CID 6055016) has the molecular formula C28H24N2O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[(Z)-(7,12-dimethylbenzo[a]anthracen-5-yl)methylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-(7,12-dimethylbenzo[a]anthracen-5-yl)methylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 6055016 |
| Molecular Formula | C28H24N2O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[(Z)-(7,12-dimethylbenzo[a]anthracen-5-yl)methylideneamino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N/N=C\c2cc3c(C)c4ccccc4c(C)c3c3ccccc23)cc1 |
| InChI | InChI=1S/C28H24N2O2S/c1-18-12-14-22(15-13-18)33(31,32)30-29-17-21-16-27-19(2)23-8-4-5-9-24(23)20(3)28(27)26-11-7-6-10-25(21)26/h4-17,30H,1-3H3/b29-17- |
| InChIKey | VCRZILDJQIWZMP-RHANQZHGSA-N |
| XLogP | 6.38 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|