C22H19ClN4O4 — CID 60550178
2-chloro-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-nitrobenzamide (PubChem CID 60550178) has the molecular formula C22H19ClN4O4 and a molecular weight of 438.87 g/mol. Its IUPAC name is 2-chloro-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-nitrobenzamide.
| Compound Name | 2-chloro-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 60550178 |
| Molecular Formula | C22H19ClN4O4 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-chloro-N-[[3-[(3-methylphenyl)carbamoylamino]phenyl]methyl]-4-nitrobenzamide |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(CNC(=O)c3ccc([N+](=O)[O-])cc3Cl)c2)c1 |
| InChI | InChI=1S/C22H19ClN4O4/c1-14-4-2-6-16(10-14)25-22(29)26-17-7-3-5-15(11-17)13-24-21(28)19-9-8-18(27(30)31)12-20(19)23/h2-12H,13H2,1H3,(H,24,28)(H2,25,26,29) |
| InChIKey | LBRLCDZERGPQQM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|