C21H21FN2O4 — CID 60554363
2-cyano-N-(2-ethoxyphenyl)-6-(2-fluorophenoxy)-3-oxohexanamide (PubChem CID 60554363) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is 2-cyano-N-(2-ethoxyphenyl)-6-(2-fluorophenoxy)-3-oxohexanamide.
| Compound Name | 2-cyano-N-(2-ethoxyphenyl)-6-(2-fluorophenoxy)-3-oxohexanamide |
|---|---|
| PubChem CID | 60554363 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 2-cyano-N-(2-ethoxyphenyl)-6-(2-fluorophenoxy)-3-oxohexanamide |
| SMILES | CCOc1ccccc1NC(=O)C(C#N)C(=O)CCCOc1ccccc1F |
| InChI | InChI=1S/C21H21FN2O4/c1-2-27-20-12-6-4-9-17(20)24-21(26)15(14-23)18(25)10-7-13-28-19-11-5-3-8-16(19)22/h3-6,8-9,11-12,15H,2,7,10,13H2,1H3,(H,24,26) |
| InChIKey | ACGHSQIUQVGFCA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|