C19H16F2N2O2 — CID 98460702
(2R,5R)-2-cyano-N-(2-fluorophenyl)-5-(4-fluorophenyl)-3-oxohexanamide (PubChem CID 98460702) has the molecular formula C19H16F2N2O2 and a molecular weight of 342.35 g/mol. Its IUPAC name is (2R,5R)-2-cyano-N-(2-fluorophenyl)-5-(4-fluorophenyl)-3-oxohexanamide.
| Compound Name | (2R,5R)-2-cyano-N-(2-fluorophenyl)-5-(4-fluorophenyl)-3-oxohexanamide |
|---|---|
| PubChem CID | 98460702 |
| Molecular Formula | C19H16F2N2O2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | (2R,5R)-2-cyano-N-(2-fluorophenyl)-5-(4-fluorophenyl)-3-oxohexanamide |
| SMILES | C[C@H](CC(=O)[C@@H](C#N)C(=O)Nc1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H16F2N2O2/c1-12(13-6-8-14(20)9-7-13)10-18(24)15(11-22)19(25)23-17-5-3-2-4-16(17)21/h2-9,12,15H,10H2,1H3,(H,23,25)/t12-,15-/m1/s1 |
| InChIKey | XUKHTWTYXCXHAE-IUODEOHRSA-N |
| XLogP | 3.81 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|