C16H20N2O2S — CID 60554371
3-pyridin-4-ylpropyl 4-methyl-2-propyl-1,3-thiazole-5-carboxylate (PubChem CID 60554371) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 4-methyl-2-propyl-1,3-thiazole-5-carboxylate.
| Compound Name | 3-pyridin-4-ylpropyl 4-methyl-2-propyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 60554371 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 3-pyridin-4-ylpropyl 4-methyl-2-propyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCc1nc(C)c(C(=O)OCCCc2ccncc2)s1 |
| InChI | InChI=1S/C16H20N2O2S/c1-3-5-14-18-12(2)15(21-14)16(19)20-11-4-6-13-7-9-17-10-8-13/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | DPLHDMMWUKSTDO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|