About 3-pyridin-4-ylpropyl 2-methylpentanoate
3-pyridin-4-ylpropyl 2-methylpentanoate (PubChem CID 78841674) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 3-pyridin-4-ylpropyl 2-methylpentanoate.
Molecular Properties
| Compound Name | 3-pyridin-4-ylpropyl 2-methylpentanoate |
| PubChem CID | 78841674 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 3-pyridin-4-ylpropyl 2-methylpentanoate |
| SMILES | CCCC(C)C(=O)OCCCc1ccncc1 |
| InChI | InChI=1S/C14H21NO2/c1-3-5-12(2)14(16)17-11-4-6-13-7-9-15-10-8-13/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | WIFILABGPQGTAQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-4-ylpropyl 2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-4-ylpropyl 2-methylpentanoate?
The IUPAC name of 3-pyridin-4-ylpropyl 2-methylpentanoate (CID 78841674) is 3-pyridin-4-ylpropyl 2-methylpentanoate.
What is the SMILES notation for 3-pyridin-4-ylpropyl 2-methylpentanoate?
The canonical SMILES for 3-pyridin-4-ylpropyl 2-methylpentanoate is CCCC(C)C(=O)OCCCc1ccncc1.
What is the InChIKey of 3-pyridin-4-ylpropyl 2-methylpentanoate?
The InChIKey is WIFILABGPQGTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c1-3-5-12(2)14(16)17-11-4-6-13-7-9-15-10-8-13/h7-10,12H,3-6,11H2,1-2H3.
What are the key properties of 3-pyridin-4-ylpropyl 2-methylpentanoate?
3-pyridin-4-ylpropyl 2-methylpentanoate has a molecular weight of 235.33 g/mol, XLogP of 2.99, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-4-ylpropyl 2-methylpentanoate is sourced from PubChem (CID 78841674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).