C21H25N5O2S — CID 60554948
2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide (PubChem CID 60554948) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide.
| Compound Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 60554948 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2-(1-ethylbenzimidazol-2-yl)sulfanyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]acetamide |
| SMILES | CCn1c(SCC(=O)Nc2ccccc2NC(=O)NC(C)C)nc2ccccc21 |
| InChI | InChI=1S/C21H25N5O2S/c1-4-26-18-12-8-7-11-17(18)25-21(26)29-13-19(27)23-15-9-5-6-10-16(15)24-20(28)22-14(2)3/h5-12,14H,4,13H2,1-3H3,(H,23,27)(H2,22,24,28) |
| InChIKey | OHPJFVGLKIJCNN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |