C19H25BrN2O3S — CID 60558311
N-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide (PubChem CID 60558311) has the molecular formula C19H25BrN2O3S and a molecular weight of 441.39 g/mol. Its IUPAC name is N-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide.
| Compound Name | N-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
|---|---|
| PubChem CID | 60558311 |
| Molecular Formula | C19H25BrN2O3S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[[1-(3-bromophenyl)cyclobutyl]methyl]-2-(2-morpholin-4-yl-2-oxoethyl)sulfanylacetamide |
| SMILES | O=C(CSCC(=O)N1CCOCC1)NCC1(c2cccc(Br)c2)CCC1 |
| InChI | InChI=1S/C19H25BrN2O3S/c20-16-4-1-3-15(11-16)19(5-2-6-19)14-21-17(23)12-26-13-18(24)22-7-9-25-10-8-22/h1,3-4,11H,2,5-10,12-14H2,(H,21,23) |
| InChIKey | XMPAFHVJHQUZSC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |