C26H25FN4O3 — CID 60558376
2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 60558376) has the molecular formula C26H25FN4O3 and a molecular weight of 460.51 g/mol. Its IUPAC name is 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60558376 |
| Molecular Formula | C26H25FN4O3 |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(2-phenylethyl)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CC1(c2ccc(F)cc2)NC(=O)N(CC(=O)N(CCc2ccccc2)Cc2cccnc2)C1=O |
| InChI | InChI=1S/C26H25FN4O3/c1-26(21-9-11-22(27)12-10-21)24(33)31(25(34)29-26)18-23(32)30(17-20-8-5-14-28-16-20)15-13-19-6-3-2-4-7-19/h2-12,14,16H,13,15,17-18H2,1H3,(H,29,34) |
| InChIKey | OAVUCWZNKQATQQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|