C13H12F2N6OS — CID 60558770
1-[4-(difluoromethoxy)phenyl]-5-[(1-methylimidazol-2-yl)sulfanylmethyl]tetrazole (PubChem CID 60558770) has the molecular formula C13H12F2N6OS and a molecular weight of 338.34 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-5-[(1-methylimidazol-2-yl)sulfanylmethyl]tetrazole.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-5-[(1-methylimidazol-2-yl)sulfanylmethyl]tetrazole |
|---|---|
| PubChem CID | 60558770 |
| Molecular Formula | C13H12F2N6OS |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-5-[(1-methylimidazol-2-yl)sulfanylmethyl]tetrazole |
| SMILES | Cn1ccnc1SCc1nnnn1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H12F2N6OS/c1-20-7-6-16-13(20)23-8-11-17-18-19-21(11)9-2-4-10(5-3-9)22-12(14)15/h2-7,12H,8H2,1H3 |
| InChIKey | GEOXSTJGSQIQLD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |