C17H9Cl2F2N5O3 — CID 55989826
5,6-dichloro-2-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]isoindole-1,3-dione (PubChem CID 55989826) has the molecular formula C17H9Cl2F2N5O3 and a molecular weight of 440.19 g/mol. Its IUPAC name is 5,6-dichloro-2-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]isoindole-1,3-dione.
| Compound Name | 5,6-dichloro-2-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 55989826 |
| Molecular Formula | C17H9Cl2F2N5O3 |
| Molecular Weight | 440.19 g/mol |
| Exact Mass | 439.01 |
| IUPAC Name | 5,6-dichloro-2-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2cc(Cl)c(Cl)cc2C(=O)N1Cc1nnnn1-c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C17H9Cl2F2N5O3/c18-12-5-10-11(6-13(12)19)16(28)25(15(10)27)7-14-22-23-24-26(14)8-1-3-9(4-2-8)29-17(20)21/h1-6,17H,7H2 |
| InChIKey | KATVXMAHDUVUPA-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.19 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|