C20H16F2N6O5 — CID 55988029
1-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 55988029) has the molecular formula C20H16F2N6O5 and a molecular weight of 458.38 g/mol. Its IUPAC name is 1-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 55988029 |
| Molecular Formula | C20H16F2N6O5 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 1-[[1-[4-(difluoromethoxy)phenyl]tetrazol-5-yl]methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(Cc2nnnn2-c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C20H16F2N6O5/c1-2-32-15-6-4-3-5-14(15)27-18(30)17(29)26(20(27)31)11-16-23-24-25-28(16)12-7-9-13(10-8-12)33-19(21)22/h3-10,19H,2,11H2,1H3 |
| InChIKey | WODVUXGUCBGHPQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 119.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|