C20H15FN4O5 — CID 55753441
1-(2-ethoxyphenyl)-3-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]imidazolidine-2,4,5-trione (PubChem CID 55753441) has the molecular formula C20H15FN4O5 and a molecular weight of 410.36 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-3-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]imidazolidine-2,4,5-trione.
| Compound Name | 1-(2-ethoxyphenyl)-3-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 55753441 |
| Molecular Formula | C20H15FN4O5 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1-(2-ethoxyphenyl)-3-[[5-(4-fluorophenyl)-1,2,4-oxadiazol-3-yl]methyl]imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(Cc2noc(-c3ccc(F)cc3)n2)C1=O |
| InChI | InChI=1S/C20H15FN4O5/c1-2-29-15-6-4-3-5-14(15)25-19(27)18(26)24(20(25)28)11-16-22-17(30-23-16)12-7-9-13(21)10-8-12/h3-10H,2,11H2,1H3 |
| InChIKey | ZUWHRYFNJWZGJU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|