C20H19BrN2O6 — CID 55875031
1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione (PubChem CID 55875031) has the molecular formula C20H19BrN2O6 and a molecular weight of 463.28 g/mol. Its IUPAC name is 1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione.
| Compound Name | 1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
|---|---|
| PubChem CID | 55875031 |
| Molecular Formula | C20H19BrN2O6 |
| Molecular Weight | 463.28 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 1-[(2-bromo-3,4-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)imidazolidine-2,4,5-trione |
| SMILES | CCOc1ccccc1N1C(=O)C(=O)N(Cc2ccc(OC)c(OC)c2Br)C1=O |
| InChI | InChI=1S/C20H19BrN2O6/c1-4-29-14-8-6-5-7-13(14)23-19(25)18(24)22(20(23)26)11-12-9-10-15(27-2)17(28-3)16(12)21/h5-10H,4,11H2,1-3H3 |
| InChIKey | DNFRZAZPLIHJEJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.28 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|