C10H7F2N3O3 — CID 134119934
2-[4-(difluoromethoxy)phenyl]-1,2,4-triazine-3,5-dione (PubChem CID 134119934) has the molecular formula C10H7F2N3O3 and a molecular weight of 255.18 g/mol. Its IUPAC name is 2-[4-(difluoromethoxy)phenyl]-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[4-(difluoromethoxy)phenyl]-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 134119934 |
| Molecular Formula | C10H7F2N3O3 |
| Molecular Weight | 255.18 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[4-(difluoromethoxy)phenyl]-1,2,4-triazine-3,5-dione |
| SMILES | O=c1cnn(-c2ccc(OC(F)F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H7F2N3O3/c11-9(12)18-7-3-1-6(2-4-7)15-10(17)14-8(16)5-13-15/h1-5,9H,(H,14,16,17) |
| InChIKey | YLKSVEUVUTWKIA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |