C11H11N3O4 — CID 12569276
2-(3,4-dimethoxyphenyl)-1,2,4-triazine-3,5-dione (PubChem CID 12569276) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,2,4-triazine-3,5-dione.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 12569276 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,2,4-triazine-3,5-dione |
| SMILES | COc1ccc(-n2ncc(=O)[nH]c2=O)cc1OC |
| InChI | InChI=1S/C11H11N3O4/c1-17-8-4-3-7(5-9(8)18-2)14-11(16)13-10(15)6-12-14/h3-6H,1-2H3,(H,13,15,16) |
| InChIKey | GJRXVXFAVDYBMP-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |