C17H13N3O4W — CID 20822967
2-methoxybenzene-5-ide-1-carbaldehyde;2-phenyl-1,2,4-triazine-3,5-dione;tungsten(2+) (PubChem CID 20822967) has the molecular formula C17H13N3O4W and a molecular weight of 507.15 g/mol. Its IUPAC name is 2-methoxybenzene-5-ide-1-carbaldehyde;2-phenyl-1,2,4-triazine-3,5-dione;tungsten(2+).
| Compound Name | 2-methoxybenzene-5-ide-1-carbaldehyde;2-phenyl-1,2,4-triazine-3,5-dione;tungsten(2+) |
|---|---|
| PubChem CID | 20822967 |
| Molecular Formula | C17H13N3O4W |
| Molecular Weight | 507.15 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | 2-methoxybenzene-5-ide-1-carbaldehyde;2-phenyl-1,2,4-triazine-3,5-dione;tungsten(2+) |
| SMILES | COc1cc[c-]cc1C=O.O=c1cnn(-c2cc[c-]cc2)c(=O)[nH]1.[W+2] |
| InChI | InChI=1S/C9H6N3O2.C8H7O2.W/c13-8-6-10-12(9(14)11-8)7-4-2-1-3-5-7;1-10-8-5-3-2-4-7(8)6-9;/h2-6H,(H,11,13,14);3-6H,1H3;/q2*-1;+2 |
| InChIKey | RPOYMZBSWBDVCO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|