C19H22N2O3 — CID 60560008
N-(4-tert-butylphenyl)-N,3-dimethyl-4-nitrobenzamide (PubChem CID 60560008) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N,3-dimethyl-4-nitrobenzamide.
| Compound Name | N-(4-tert-butylphenyl)-N,3-dimethyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 60560008 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-(4-tert-butylphenyl)-N,3-dimethyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)N(C)c2ccc(C(C)(C)C)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H22N2O3/c1-13-12-14(6-11-17(13)21(23)24)18(22)20(5)16-9-7-15(8-10-16)19(2,3)4/h6-12H,1-5H3 |
| InChIKey | GVKAZJNMMOMCOZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|